C45H51N7O7 — CID 101204321
12,18-bis(4-nitrophenyl)-4,26,31-trioxa-1,12,15,18,39-pentazapentacyclo[13.13.13.05,10.020,25.032,37]hentetraconta-5,7,9,20,22,24,32,34,36-nonaene (PubChem CID 101204321) has the molecular formula C45H51N7O7 and a molecular weight of 801.95 g/mol. Its IUPAC name is 12,18-bis(4-nitrophenyl)-4,26,31-trioxa-1,12,15,18,39-pentazapentacyclo[13.13.13.05,10.020,25.032,37]hentetraconta-5,7,9,20,22,24,32,34,36-nonaene.
| Compound Name | 12,18-bis(4-nitrophenyl)-4,26,31-trioxa-1,12,15,18,39-pentazapentacyclo[13.13.13.05,10.020,25.032,37]hentetraconta-5,7,9,20,22,24,32,34,36-nonaene |
|---|---|
| PubChem CID | 101204321 |
| Molecular Formula | C45H51N7O7 |
| Molecular Weight | 801.95 g/mol |
| Exact Mass | 801.38 |
| IUPAC Name | 12,18-bis(4-nitrophenyl)-4,26,31-trioxa-1,12,15,18,39-pentazapentacyclo[13.13.13.05,10.020,25.032,37]hentetraconta-5,7,9,20,22,24,32,34,36-nonaene |
| SMILES | O=[N+]([O-])c1ccc(N2CCN3CCNCc4ccccc4OCCN(CCOc4ccccc4C2)CCOc2ccccc2CN(c2ccc([N+](=O)[O-])cc2)CC3)cc1 |
| InChI | InChI=1S/C45H51N7O7/c53-51(54)41-17-13-39(14-18-41)49-25-23-47-22-21-46-33-36-7-1-4-10-43(36)57-30-27-48(28-31-58-44-11-5-2-8-37(44)34-49)29-32-59-45-12-6-3-9-38(45)35-50(26-24-47)40-15-19-42(20-16-40)52(55)56/h1-20,46H,21-35H2 |
| InChIKey | AGNAECWPKKFQMA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.95 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|