About 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one
2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one (PubChem CID 10120447) has the molecular formula C7H11N5O
and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one |
| PubChem CID | 10120447 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CCN1C=NC2C(=O)NC(N)=NC21 |
| InChI | InChI=1S/C7H11N5O/c1-2-12-3-9-4-5(12)10-7(8)11-6(4)13/h3-5H,2H2,1H3,(H3,8,10,11,13) |
| InChIKey | HMIFWDRXVYQVSL-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one?
The IUPAC name of 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one (CID 10120447) is 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one?
The canonical SMILES for 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one is CCN1C=NC2C(=O)NC(N)=NC21.
What is the InChIKey of 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one?
The InChIKey is HMIFWDRXVYQVSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O/c1-2-12-3-9-4-5(12)10-7(8)11-6(4)13/h3-5H,2H2,1H3,(H3,8,10,11,13).
What are the key properties of 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one?
2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one has a molecular weight of 181.20 g/mol, XLogP of -1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-ethyl-4,5-dihydro-1H-purin-6-one is sourced from PubChem (CID 10120447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).