About CID 101204504
CID 101204504 (PubChem CID 101204504) has the molecular formula C4NO
and a molecular weight of 78.05 g/mol.
Molecular Properties
| Compound Name | CID 101204504 |
| PubChem CID | 101204504 |
| Molecular Formula | C4NO |
| Molecular Weight | 78.05 g/mol |
| Exact Mass | 78.00 |
| IUPAC Name | — |
| SMILES | N#Cc1[c]c1=O |
| InChI | InChI=1S/C4NO/c5-2-3-1-4(3)6 |
| InChIKey | JFEFLSFXLBSUPE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.05 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101204504 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101204504?
The IUPAC name of CID 101204504 (CID 101204504) is not available.
What is the SMILES notation for CID 101204504?
The canonical SMILES for CID 101204504 is N#Cc1[c]c1=O.
What is the InChIKey of CID 101204504?
The InChIKey is JFEFLSFXLBSUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4NO/c5-2-3-1-4(3)6.
What are the key properties of CID 101204504?
CID 101204504 has a molecular weight of 78.05 g/mol, XLogP of -0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101204504 is sourced from PubChem (CID 101204504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).