About N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide
N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide (PubChem CID 101204507) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide |
| PubChem CID | 101204507 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide |
| SMILES | O=C(CNC(=O)C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C13H13NO2/c15-12(10-5-1-2-6-10)9-14-13(16)11-7-3-4-8-11/h1-8,10-11H,9H2,(H,14,16) |
| InChIKey | IQDXDWSYSCDRSA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide?
The IUPAC name of N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide (CID 101204507) is N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide.
What is the SMILES notation for N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide?
The canonical SMILES for N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide is O=C(CNC(=O)C1C=CC=C1)C1C=CC=C1.
What is the InChIKey of N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide?
The InChIKey is IQDXDWSYSCDRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c15-12(10-5-1-2-6-10)9-14-13(16)11-7-3-4-8-11/h1-8,10-11H,9H2,(H,14,16).
What are the key properties of N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide?
N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide has a molecular weight of 215.25 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopenta-2,4-dien-1-yl-2-oxoethyl)cyclopenta-2,4-diene-1-carboxamide is sourced from PubChem (CID 101204507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).