C15H23NO2 — CID 101204595
(3S)-3-(4-methoxyanilino)-5,5-dimethylhexan-2-one (PubChem CID 101204595) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (3S)-3-(4-methoxyanilino)-5,5-dimethylhexan-2-one.
| Compound Name | (3S)-3-(4-methoxyanilino)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 101204595 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (3S)-3-(4-methoxyanilino)-5,5-dimethylhexan-2-one |
| SMILES | COc1ccc(N[C@@H](CC(C)(C)C)C(C)=O)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-11(17)14(10-15(2,3)4)16-12-6-8-13(18-5)9-7-12/h6-9,14,16H,10H2,1-5H3/t14-/m0/s1 |
| InChIKey | MUOQJKVZSVLQKZ-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|