C29H48O3Si2 — CID 101204670
[(3aR,4S,9S,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a-(3-methoxyprop-1-ynyl)-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-9-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101204670) has the molecular formula C29H48O3Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is [(3aR,4S,9S,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a-(3-methoxyprop-1-ynyl)-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-9-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,9S,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a-(3-methoxyprop-1-ynyl)-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-9-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101204670 |
| Molecular Formula | C29H48O3Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | [(3aR,4S,9S,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a-(3-methoxyprop-1-ynyl)-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-9-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCC#C[C@@]12CCC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H48O3Si2/c1-27(2,3)33(8,9)31-25-22-16-12-13-17-23(22)26(32-34(10,11)28(4,5)6)29(20-15-21-30-7)19-14-18-24(25)29/h12-13,16-17,24-26H,14,18-19,21H2,1-11H3/t24-,25-,26+,29+/m1/s1 |
| InChIKey | MZFSODQVYOGLQU-JMDODURXSA-N |
| XLogP | 8.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|