C15H22O — CID 101204921
(1aR,2S,7aR,7bS)-4,7a-dimethyl-2-prop-1-en-2-yl-2,3,5,6,7,7b-hexahydro-1aH-naphtho[1,2-b]oxirene (PubChem CID 101204921) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1aR,2S,7aR,7bS)-4,7a-dimethyl-2-prop-1-en-2-yl-2,3,5,6,7,7b-hexahydro-1aH-naphtho[1,2-b]oxirene.
| Compound Name | (1aR,2S,7aR,7bS)-4,7a-dimethyl-2-prop-1-en-2-yl-2,3,5,6,7,7b-hexahydro-1aH-naphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 101204921 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1aR,2S,7aR,7bS)-4,7a-dimethyl-2-prop-1-en-2-yl-2,3,5,6,7,7b-hexahydro-1aH-naphtho[1,2-b]oxirene |
| SMILES | C=C(C)[C@@H]1CC2=C(C)CCC[C@@]2(C)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C15H22O/c1-9(2)11-8-12-10(3)6-5-7-15(12,4)14-13(11)16-14/h11,13-14H,1,5-8H2,2-4H3/t11-,13+,14+,15+/m0/s1 |
| InChIKey | HPCVOEQSOLQFPZ-ZGKBOVNRSA-N |
| XLogP | 3.86 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|