C31H62N8 — CID 101205585
1-[2-[3-[2-[4,7-di(propan-2-yl)-1,4,7-triazonan-1-yl]ethyl]-1H-pyrazol-5-yl]ethyl]-4,7-di(propan-2-yl)-1,4,7-triazonane (PubChem CID 101205585) has the molecular formula C31H62N8 and a molecular weight of 546.89 g/mol. Its IUPAC name is 1-[2-[3-[2-[4,7-di(propan-2-yl)-1,4,7-triazonan-1-yl]ethyl]-1H-pyrazol-5-yl]ethyl]-4,7-di(propan-2-yl)-1,4,7-triazonane.
| Compound Name | 1-[2-[3-[2-[4,7-di(propan-2-yl)-1,4,7-triazonan-1-yl]ethyl]-1H-pyrazol-5-yl]ethyl]-4,7-di(propan-2-yl)-1,4,7-triazonane |
|---|---|
| PubChem CID | 101205585 |
| Molecular Formula | C31H62N8 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 546.51 |
| IUPAC Name | 1-[2-[3-[2-[4,7-di(propan-2-yl)-1,4,7-triazonan-1-yl]ethyl]-1H-pyrazol-5-yl]ethyl]-4,7-di(propan-2-yl)-1,4,7-triazonane |
| SMILES | CC(C)N1CCN(CCc2cc(CCN3CCN(C(C)C)CCN(C(C)C)CC3)[nH]n2)CCN(C(C)C)CC1 |
| InChI | InChI=1S/C31H62N8/c1-26(2)36-17-13-34(14-18-37(22-21-36)27(3)4)11-9-30-25-31(33-32-30)10-12-35-15-19-38(28(5)6)23-24-39(20-16-35)29(7)8/h25-29H,9-24H2,1-8H3,(H,32,33) |
| InChIKey | KDFIPTUUJAGNOI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |