C15H28O3 — CID 101205699
[(2R,4S,7R,9R,11S)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodecan-7-yl]methanol (PubChem CID 101205699) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is [(2R,4S,7R,9R,11S)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodecan-7-yl]methanol.
| Compound Name | [(2R,4S,7R,9R,11S)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodecan-7-yl]methanol |
|---|---|
| PubChem CID | 101205699 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | [(2R,4S,7R,9R,11S)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodecan-7-yl]methanol |
| SMILES | C[C@@H]1C[C@H](C)CC2(O[C@H](C)C[C@H](C)O2)[C@@H](CO)C1 |
| InChI | InChI=1S/C15H28O3/c1-10-5-11(2)8-15(14(6-10)9-16)17-12(3)7-13(4)18-15/h10-14,16H,5-9H2,1-4H3/t10-,11+,12-,13+,14-,15?/m1/s1 |
| InChIKey | FHCZCJNOLUMAEX-WQFUOLRDSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |