C21H21N5+2 — CID 101205744
3,17,23-triaza-6,14-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),4,6(26),8(25),9,11,14(24),15,19,21-decaene (PubChem CID 101205744) has the molecular formula C21H21N5+2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3,17,23-triaza-6,14-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),4,6(26),8(25),9,11,14(24),15,19,21-decaene.
| Compound Name | 3,17,23-triaza-6,14-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),4,6(26),8(25),9,11,14(24),15,19,21-decaene |
|---|---|
| PubChem CID | 101205744 |
| Molecular Formula | C21H21N5+2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3,17,23-triaza-6,14-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),4,6(26),8(25),9,11,14(24),15,19,21-decaene |
| SMILES | c1cc2cc(c1)C[n+]1ccn(c1)Cc1cccc(n1)Cn1cc[n+](c1)C2 |
| InChI | InChI=1S/C21H21N5/c1-3-18-11-19(4-1)13-24-8-10-26(17-24)15-21-6-2-5-20(22-21)14-25-9-7-23(12-18)16-25/h1-11,16-17H,12-15H2/q+2 |
| InChIKey | MFHCTQZRECUOQY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|