C19H27N — CID 101206038
(2Z,5Z,7Z)-N,N-diethyl-9-phenylnona-2,5,7-trien-1-amine (PubChem CID 101206038) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (2Z,5Z,7Z)-N,N-diethyl-9-phenylnona-2,5,7-trien-1-amine.
| Compound Name | (2Z,5Z,7Z)-N,N-diethyl-9-phenylnona-2,5,7-trien-1-amine |
|---|---|
| PubChem CID | 101206038 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (2Z,5Z,7Z)-N,N-diethyl-9-phenylnona-2,5,7-trien-1-amine |
| SMILES | CCN(CC)C/C=C\C/C=C\C=C/Cc1ccccc1 |
| InChI | InChI=1S/C19H27N/c1-3-20(4-2)18-14-9-7-5-6-8-11-15-19-16-12-10-13-17-19/h5-6,8-14,16-17H,3-4,7,15,18H2,1-2H3/b6-5-,11-8-,14-9- |
| InChIKey | RCELIBFMWWCBCN-DLONEJLKSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|