C26H24S2 — CID 101206627
2-methyl-5-[11-(5-methylthiophen-2-yl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]thiophene (PubChem CID 101206627) has the molecular formula C26H24S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 2-methyl-5-[11-(5-methylthiophen-2-yl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]thiophene.
| Compound Name | 2-methyl-5-[11-(5-methylthiophen-2-yl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]thiophene |
|---|---|
| PubChem CID | 101206627 |
| Molecular Formula | C26H24S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-methyl-5-[11-(5-methylthiophen-2-yl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]thiophene |
| SMILES | Cc1ccc(-c2cc3ccc2CCc2ccc(c(-c4ccc(C)s4)c2)CC3)s1 |
| InChI | InChI=1S/C26H24S2/c1-17-3-13-25(27-17)23-15-19-5-9-21(23)11-7-20-6-10-22(12-8-19)24(16-20)26-14-4-18(2)28-26/h3-6,9-10,13-16H,7-8,11-12H2,1-2H3 |
| InChIKey | OOKGEUYOBAGMLI-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |