C12H16O2 — CID 101207572
(3'aS,7'aS)-3'-methylidenespiro[1,3-dioxolane-2,6'-2,3a,7,7a-tetrahydro-1H-indene] (PubChem CID 101207572) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3'aS,7'aS)-3'-methylidenespiro[1,3-dioxolane-2,6'-2,3a,7,7a-tetrahydro-1H-indene].
| Compound Name | (3'aS,7'aS)-3'-methylidenespiro[1,3-dioxolane-2,6'-2,3a,7,7a-tetrahydro-1H-indene] |
|---|---|
| PubChem CID | 101207572 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3'aS,7'aS)-3'-methylidenespiro[1,3-dioxolane-2,6'-2,3a,7,7a-tetrahydro-1H-indene] |
| SMILES | C=C1CC[C@H]2CC3(C=C[C@@H]12)OCCO3 |
| InChI | InChI=1S/C12H16O2/c1-9-2-3-10-8-12(5-4-11(9)10)13-6-7-14-12/h4-5,10-11H,1-3,6-8H2/t10-,11-/m0/s1 |
| InChIKey | CYQJOQXEDRUZOY-QWRGUYRKSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|