C26H51IO4Si2 — CID 101207678
tert-butyl-[(E)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]pent-1-en-3-yl]oxy-dimethylsilane (PubChem CID 101207678) has the molecular formula C26H51IO4Si2 and a molecular weight of 610.77 g/mol. Its IUPAC name is tert-butyl-[(E)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]pent-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]pent-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101207678 |
| Molecular Formula | C26H51IO4Si2 |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | tert-butyl-[(E)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]pent-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCOC(CI)O[C@@H]1C=C[C@H](O[Si](/C=C/C(CC)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C26H51IO4Si2/c1-12-22(30-32(10,11)26(7,8)9)16-17-33(20(3)4,21(5)6)31-24-15-14-23(18-24)29-25(19-27)28-13-2/h14-17,20-25H,12-13,18-19H2,1-11H3/b17-16+/t22?,23-,24+,25?/m1/s1 |
| InChIKey | MFKWBRORVGUEMZ-SPSDEIGZSA-N |
| XLogP | 8.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|