C32H65IO5Si3 — CID 101207679
[(E,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-enyl]-[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silane (PubChem CID 101207679) has the molecular formula C32H65IO5Si3 and a molecular weight of 741.03 g/mol. Its IUPAC name is [(E,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-enyl]-[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silane.
| Compound Name | [(E,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-enyl]-[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 101207679 |
| Molecular Formula | C32H65IO5Si3 |
| Molecular Weight | 741.03 g/mol |
| Exact Mass | 740.32 |
| IUPAC Name | [(E,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-enyl]-[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silane |
| SMILES | CCOC(CI)O[C@@H]1C=C[C@H](O[Si](/C=C/[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C32H65IO5Si3/c1-16-34-30(24-33)36-28-17-18-29(23-28)38-41(25(2)3,26(4)5)22-20-27(37-40(14,15)32(9,10)11)19-21-35-39(12,13)31(6,7)8/h17-18,20,22,25-30H,16,19,21,23-24H2,1-15H3/b22-20+/t27-,28+,29-,30?/m0/s1 |
| InChIKey | BQMNKSMKEZXZQT-KGQBXZJFSA-N |
| XLogP | 10.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.03 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|