C29H55IO4Si2 — CID 101207680
tert-butyl-[(1E,3S,5Z)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]octa-1,5-dien-3-yl]oxy-dimethylsilane (PubChem CID 101207680) has the molecular formula C29H55IO4Si2 and a molecular weight of 650.83 g/mol. Its IUPAC name is tert-butyl-[(1E,3S,5Z)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]octa-1,5-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3S,5Z)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]octa-1,5-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101207680 |
| Molecular Formula | C29H55IO4Si2 |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | tert-butyl-[(1E,3S,5Z)-1-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]octa-1,5-dien-3-yl]oxy-dimethylsilane |
| SMILES | CC/C=C\C[C@@H](/C=C/[Si](O[C@H]1C=C[C@@H](OC(CI)OCC)C1)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H55IO4Si2/c1-12-14-15-16-25(33-35(10,11)29(7,8)9)19-20-36(23(3)4,24(5)6)34-27-18-17-26(21-27)32-28(22-30)31-13-2/h14-15,17-20,23-28H,12-13,16,21-22H2,1-11H3/b15-14-,20-19+/t25-,26+,27-,28?/m0/s1 |
| InChIKey | RDHDBDXOEYTWSV-STAYNHEESA-N |
| XLogP | 9.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|