About 5,7-dimethyl-1H-1,4-diazepine
5,7-dimethyl-1H-1,4-diazepine (PubChem CID 101208545) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 5,7-dimethyl-1H-1,4-diazepine.
Molecular Properties
| Compound Name | 5,7-dimethyl-1H-1,4-diazepine |
| PubChem CID | 101208545 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 5,7-dimethyl-1H-1,4-diazepine |
| SMILES | CC1=CC(C)=NC=CN1 |
| InChI | InChI=1S/C7H10N2/c1-6-5-7(2)9-4-3-8-6/h3-5,8H,1-2H3 |
| InChIKey | UVQZTFVHAVTYSO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dimethyl-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-1H-1,4-diazepine?
The IUPAC name of 5,7-dimethyl-1H-1,4-diazepine (CID 101208545) is 5,7-dimethyl-1H-1,4-diazepine.
What is the SMILES notation for 5,7-dimethyl-1H-1,4-diazepine?
The canonical SMILES for 5,7-dimethyl-1H-1,4-diazepine is CC1=CC(C)=NC=CN1.
What is the InChIKey of 5,7-dimethyl-1H-1,4-diazepine?
The InChIKey is UVQZTFVHAVTYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-6-5-7(2)9-4-3-8-6/h3-5,8H,1-2H3.
What are the key properties of 5,7-dimethyl-1H-1,4-diazepine?
5,7-dimethyl-1H-1,4-diazepine has a molecular weight of 122.17 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-1H-1,4-diazepine is sourced from PubChem (CID 101208545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).