About 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine
3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine (PubChem CID 101209812) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine |
| PubChem CID | 101209812 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC/N=C/C1=CC=CC1 |
| InChI | InChI=1S/C11H18N2/c1-13(2)9-5-8-12-10-11-6-3-4-7-11/h3-4,6,10H,5,7-9H2,1-2H3/b12-10+ |
| InChIKey | CCGMGHCQZXIAAC-ZRDIBKRKSA-N |
| XLogP | 1.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine (CID 101209812) is 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine is CN(C)CCC/N=C/C1=CC=CC1.
What is the InChIKey of 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine?
The InChIKey is CCGMGHCQZXIAAC-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H18N2/c1-13(2)9-5-8-12-10-11-6-3-4-7-11/h3-4,6,10H,5,7-9H2,1-2H3/b12-10+.
What are the key properties of 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine?
3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine has a molecular weight of 178.28 g/mol, XLogP of 1.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopenta-1,3-dien-1-ylmethylideneamino)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 101209812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).