C21H14F10N2O4S — CID 10120990
2-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10120990) has the molecular formula C21H14F10N2O4S and a molecular weight of 580.40 g/mol. Its IUPAC name is 2-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10120990 |
| Molecular Formula | C21H14F10N2O4S |
| Molecular Weight | 580.40 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 2-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OC(F)F)c(OC(F)F)c2)c2cnc(C(O)(C(F)(F)F)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C21H14F10N2O4S/c22-17(23)36-13-2-1-11(8-14(13)37-18(24)25)12(7-10-3-5-33(35)6-4-10)15-9-32-16(38-15)19(34,20(26,27)28)21(29,30)31/h1-6,8-9,12,17-18,34H,7H2 |
| InChIKey | PSKZOQZOHVTJTC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|