C15H20OS — CID 101209955
1-[[(1S,5S)-5-methoxycyclohex-2-en-1-yl]methylsulfanyl]-4-methylbenzene (PubChem CID 101209955) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-[[(1S,5S)-5-methoxycyclohex-2-en-1-yl]methylsulfanyl]-4-methylbenzene.
| Compound Name | 1-[[(1S,5S)-5-methoxycyclohex-2-en-1-yl]methylsulfanyl]-4-methylbenzene |
|---|---|
| PubChem CID | 101209955 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[[(1S,5S)-5-methoxycyclohex-2-en-1-yl]methylsulfanyl]-4-methylbenzene |
| SMILES | CO[C@H]1CC=C[C@@H](CSc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C15H20OS/c1-12-6-8-15(9-7-12)17-11-13-4-3-5-14(10-13)16-2/h3-4,6-9,13-14H,5,10-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | GLLLZUMURCMTNC-KGLIPLIRSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|