C27H23NO5 — CID 101210120
3-(3,5-dimethoxy-11-oxo-4-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-yl)propanal (PubChem CID 101210120) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 3-(3,5-dimethoxy-11-oxo-4-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-yl)propanal.
| Compound Name | 3-(3,5-dimethoxy-11-oxo-4-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-yl)propanal |
|---|---|
| PubChem CID | 101210120 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-(3,5-dimethoxy-11-oxo-4-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-yl)propanal |
| SMILES | COc1cc2cc3c4c(cccc4c2c(OC)c1OCc1ccccc1)C(=O)N3CCC=O |
| InChI | InChI=1S/C27H23NO5/c1-31-22-15-18-14-21-24-19(10-6-11-20(24)27(30)28(21)12-7-13-29)23(18)26(32-2)25(22)33-16-17-8-4-3-5-9-17/h3-6,8-11,13-15H,7,12,16H2,1-2H3 |
| InChIKey | FKQOESAJDNPHHO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|