About CID 101210283
CID 101210283 (PubChem CID 101210283) has the molecular formula C2H4O2-
and a molecular weight of 60.05 g/mol.
Molecular Properties
| Compound Name | CID 101210283 |
| PubChem CID | 101210283 |
| Molecular Formula | C2H4O2- |
| Molecular Weight | 60.05 g/mol |
| Exact Mass | 60.02 |
| IUPAC Name | — |
| SMILES | CC([O])[O-] |
| InChI | InChI=1S/C2H4O2/c1-2(3)4/h2H,1H3/q-1 |
| InChIKey | HWYJOOSHTZPVLU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 42.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 60.05 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 101210283 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101210283?
The IUPAC name of CID 101210283 (CID 101210283) is not available.
What is the SMILES notation for CID 101210283?
The canonical SMILES for CID 101210283 is CC([O])[O-].
What is the InChIKey of CID 101210283?
The InChIKey is HWYJOOSHTZPVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2/c1-2(3)4/h2H,1H3/q-1.
What are the key properties of CID 101210283?
CID 101210283 has a molecular weight of 60.05 g/mol, XLogP of -0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101210283 is sourced from PubChem (CID 101210283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).