C14H29N2O5P — CID 101210571
[1-[[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxohexan-2-yl]phosphonic acid (PubChem CID 101210571) has the molecular formula C14H29N2O5P and a molecular weight of 336.37 g/mol. Its IUPAC name is [1-[[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxohexan-2-yl]phosphonic acid.
| Compound Name | [1-[[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxohexan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 101210571 |
| Molecular Formula | C14H29N2O5P |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [1-[[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxohexan-2-yl]phosphonic acid |
| SMILES | CCCCC(C(=O)N[C@H](C(=O)N(C)C)C(C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C14H29N2O5P/c1-7-8-9-10(22(19,20)21)12(17)15-11(14(2,3)4)13(18)16(5)6/h10-11H,7-9H2,1-6H3,(H,15,17)(H2,19,20,21)/t10?,11-/m1/s1 |
| InChIKey | PUQQTEJGQOFAAH-RRKGBCIJSA-N |
| XLogP | 1.34 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|