C27H40O9 — CID 101210755
[(3R,4R)-4-hydroxy-3-methyl-6-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]oxyhexyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 101210755) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(3R,4R)-4-hydroxy-3-methyl-6-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]oxyhexyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(3R,4R)-4-hydroxy-3-methyl-6-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]oxyhexyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 101210755 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(3R,4R)-4-hydroxy-3-methyl-6-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]oxyhexyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | C[C@H](CCOC(=O)[C@@]12CC[C@@](C)(C(=O)O1)C2(C)C)[C@H](O)CCOC(=O)[C@@]12CC[C@@](C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C27H40O9/c1-16(8-14-33-20(31)26-12-10-24(6,18(29)35-26)22(26,2)3)17(28)9-15-34-21(32)27-13-11-25(7,19(30)36-27)23(27,4)5/h16-17,28H,8-15H2,1-7H3/t16-,17-,24+,25+,26-,27-/m1/s1 |
| InChIKey | YPJLFQWVXLFPHV-PQARDCOISA-N |
| XLogP | 3.09 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|