C25H14F6O2S2 — CID 101211724
3-[3,3,4,4,5,5-hexafluoro-2-(6-formyl-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbaldehyde (PubChem CID 101211724) has the molecular formula C25H14F6O2S2 and a molecular weight of 524.51 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(6-formyl-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbaldehyde.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(6-formyl-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbaldehyde |
|---|---|
| PubChem CID | 101211724 |
| Molecular Formula | C25H14F6O2S2 |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(6-formyl-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbaldehyde |
| SMILES | Cc1sc2cc(C=O)ccc2c1C1=C(c2c(C)sc3cc(C=O)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H14F6O2S2/c1-11-19(15-5-3-13(9-32)7-17(15)34-11)21-22(24(28,29)25(30,31)23(21,26)27)20-12(2)35-18-8-14(10-33)4-6-16(18)20/h3-10H,1-2H3 |
| InChIKey | AQTVNAMMPQPLBG-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|