C15H22O3 — CID 101212249
(1R,2R,2'S,3R,4R,7S)-7-ethenyl-2-hydroxy-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carbaldehyde (PubChem CID 101212249) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2R,2'S,3R,4R,7S)-7-ethenyl-2-hydroxy-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carbaldehyde.
| Compound Name | (1R,2R,2'S,3R,4R,7S)-7-ethenyl-2-hydroxy-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carbaldehyde |
|---|---|
| PubChem CID | 101212249 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2R,2'S,3R,4R,7S)-7-ethenyl-2-hydroxy-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carbaldehyde |
| SMILES | C=C[C@H]1[C@H]2CC[C@]1(C=O)[C@H](O)[C@@]21CCC[C@@H]1OC |
| InChI | InChI=1S/C15H22O3/c1-3-10-11-6-8-14(10,9-16)13(17)15(11)7-4-5-12(15)18-2/h3,9-13,17H,1,4-8H2,2H3/t10-,11+,12-,13-,14+,15-/m0/s1 |
| InChIKey | DWOLEIBLIYVXSO-HGPDSQILSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|