About 2-tert-butyl-5-methylsulfonyl-1,3-dioxane
2-tert-butyl-5-methylsulfonyl-1,3-dioxane (PubChem CID 101212588) has the molecular formula C9H18O4S
and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-tert-butyl-5-methylsulfonyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-tert-butyl-5-methylsulfonyl-1,3-dioxane |
| PubChem CID | 101212588 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-tert-butyl-5-methylsulfonyl-1,3-dioxane |
| SMILES | CC(C)(C)C1OCC(S(C)(=O)=O)CO1 |
| InChI | InChI=1S/C9H18O4S/c1-9(2,3)8-12-5-7(6-13-8)14(4,10)11/h7-8H,5-6H2,1-4H3 |
| InChIKey | FDHRHCWOZMLAIW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-5-methylsulfonyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-methylsulfonyl-1,3-dioxane?
The IUPAC name of 2-tert-butyl-5-methylsulfonyl-1,3-dioxane (CID 101212588) is 2-tert-butyl-5-methylsulfonyl-1,3-dioxane.
What is the SMILES notation for 2-tert-butyl-5-methylsulfonyl-1,3-dioxane?
The canonical SMILES for 2-tert-butyl-5-methylsulfonyl-1,3-dioxane is CC(C)(C)C1OCC(S(C)(=O)=O)CO1.
What is the InChIKey of 2-tert-butyl-5-methylsulfonyl-1,3-dioxane?
The InChIKey is FDHRHCWOZMLAIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S/c1-9(2,3)8-12-5-7(6-13-8)14(4,10)11/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-tert-butyl-5-methylsulfonyl-1,3-dioxane?
2-tert-butyl-5-methylsulfonyl-1,3-dioxane has a molecular weight of 222.31 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-methylsulfonyl-1,3-dioxane is sourced from PubChem (CID 101212588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).