C8H9NO5 — CID 101212710
methyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-hydroxypropanoate (PubChem CID 101212710) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is methyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 101212710 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | methyl (2S)-2-(2,5-dioxopyrrol-1-yl)-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H9NO5/c1-14-8(13)5(4-10)9-6(11)2-3-7(9)12/h2-3,5,10H,4H2,1H3/t5-/m0/s1 |
| InChIKey | JGYWQBAXKBUNHT-YFKPBYRVSA-N |
| XLogP | -1.55 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|