C28H42N8O6 — CID 101212829
(12S)-7-[4-[(12S)-3,11-dioxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-7-yl]-2,5-dihydroxyphenyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-3,11-dione (PubChem CID 101212829) has the molecular formula C28H42N8O6 and a molecular weight of 586.69 g/mol. Its IUPAC name is (12S)-7-[4-[(12S)-3,11-dioxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-7-yl]-2,5-dihydroxyphenyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-3,11-dione.
| Compound Name | (12S)-7-[4-[(12S)-3,11-dioxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-7-yl]-2,5-dihydroxyphenyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-3,11-dione |
|---|---|
| PubChem CID | 101212829 |
| Molecular Formula | C28H42N8O6 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | (12S)-7-[4-[(12S)-3,11-dioxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-7-yl]-2,5-dihydroxyphenyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-3,11-dione |
| SMILES | O=C1CN2CCC[C@H]2C(=O)NCCN(c2cc(O)c(N3CCNC(=O)CN4CCC[C@H]4C(=O)NCC3)cc2O)CCN1 |
| InChI | InChI=1S/C28H42N8O6/c37-23-16-22(34-12-6-30-26(40)18-36-10-2-4-20(36)28(42)32-8-14-34)24(38)15-21(23)33-11-5-29-25(39)17-35-9-1-3-19(35)27(41)31-7-13-33/h15-16,19-20,37-38H,1-14,17-18H2,(H,29,39)(H,30,40)(H,31,41)(H,32,42)/t19-,20-/m0/s1 |
| InChIKey | FSZWXMSLHAWDIW-PMACEKPBSA-N |
| XLogP | -1.87 |
| TPSA | 169.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|