C19H23N3 — CID 101212996
(8R,9R,10R)-9-ethyl-10-methyl-2-phenyl-3,12,13-triazatricyclo[6.4.1.04,13]trideca-1,3,11-triene (PubChem CID 101212996) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (8R,9R,10R)-9-ethyl-10-methyl-2-phenyl-3,12,13-triazatricyclo[6.4.1.04,13]trideca-1,3,11-triene.
| Compound Name | (8R,9R,10R)-9-ethyl-10-methyl-2-phenyl-3,12,13-triazatricyclo[6.4.1.04,13]trideca-1,3,11-triene |
|---|---|
| PubChem CID | 101212996 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (8R,9R,10R)-9-ethyl-10-methyl-2-phenyl-3,12,13-triazatricyclo[6.4.1.04,13]trideca-1,3,11-triene |
| SMILES | CC[C@H]1[C@H]2CCCc3nc(-c4ccccc4)c(n32)N=C[C@@H]1C |
| InChI | InChI=1S/C19H23N3/c1-3-15-13(2)12-20-19-18(14-8-5-4-6-9-14)21-17-11-7-10-16(15)22(17)19/h4-6,8-9,12-13,15-16H,3,7,10-11H2,1-2H3/t13-,15+,16+/m0/s1 |
| InChIKey | CTBRPIMUPJRDTG-NUEKZKHPSA-N |
| XLogP | 4.81 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |