C34H20N6OS2 — CID 10121304
10-[8-(3,6-diphenylimidazo[4,5-b]pyridin-2-yl)-3lambda4,7-dithia-2,4-diazabicyclo[3.3.0]octa-1(8),2,3,5-tetraen-6-yl]phenoxazine (PubChem CID 10121304) has the molecular formula C34H20N6OS2 and a molecular weight of 592.71 g/mol. Its IUPAC name is 10-[8-(3,6-diphenylimidazo[4,5-b]pyridin-2-yl)-3lambda4,7-dithia-2,4-diazabicyclo[3.3.0]octa-1(8),2,3,5-tetraen-6-yl]phenoxazine.
| Compound Name | 10-[8-(3,6-diphenylimidazo[4,5-b]pyridin-2-yl)-3lambda4,7-dithia-2,4-diazabicyclo[3.3.0]octa-1(8),2,3,5-tetraen-6-yl]phenoxazine |
|---|---|
| PubChem CID | 10121304 |
| Molecular Formula | C34H20N6OS2 |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 10-[8-(3,6-diphenylimidazo[4,5-b]pyridin-2-yl)-3lambda4,7-dithia-2,4-diazabicyclo[3.3.0]octa-1(8),2,3,5-tetraen-6-yl]phenoxazine |
| SMILES | c1ccc(-c2cnc3c(c2)nc(-c2sc(N4c5ccccc5Oc5ccccc54)c4c2N=S=N4)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H20N6OS2/c1-3-11-21(12-4-1)22-19-24-32(35-20-22)39(23-13-5-2-6-14-23)33(36-24)31-29-30(38-43-37-29)34(42-31)40-25-15-7-9-17-27(25)41-28-18-10-8-16-26(28)40/h1-20H |
| InChIKey | YEIHDNCAZYHIJS-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |