About CID 101213352
CID 101213352 (PubChem CID 101213352) has the molecular formula C11H13O2
and a molecular weight of 177.22 g/mol.
Molecular Properties
| Compound Name | CID 101213352 |
| PubChem CID | 101213352 |
| Molecular Formula | C11H13O2 |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | — |
| SMILES | C[C@H]1CCO[C](c2ccccc2)O1 |
| InChI | InChI=1S/C11H13O2/c1-9-7-8-12-11(13-9)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | PTWJGBUHVAZLJS-VIFPVBQESA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101213352 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101213352?
The IUPAC name of CID 101213352 (CID 101213352) is not available.
What is the SMILES notation for CID 101213352?
The canonical SMILES for CID 101213352 is C[C@H]1CCO[C](c2ccccc2)O1.
What is the InChIKey of CID 101213352?
The InChIKey is PTWJGBUHVAZLJS-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13O2/c1-9-7-8-12-11(13-9)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m0/s1.
What are the key properties of CID 101213352?
CID 101213352 has a molecular weight of 177.22 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101213352 is sourced from PubChem (CID 101213352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).