C20H22N2 — CID 101213672
12,13-dimethylidenecyclooctadeca-2,4,6,8,10,14,16,18-octaene-1,6-diamine (PubChem CID 101213672) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 12,13-dimethylidenecyclooctadeca-2,4,6,8,10,14,16,18-octaene-1,6-diamine.
| Compound Name | 12,13-dimethylidenecyclooctadeca-2,4,6,8,10,14,16,18-octaene-1,6-diamine |
|---|---|
| PubChem CID | 101213672 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 12,13-dimethylidenecyclooctadeca-2,4,6,8,10,14,16,18-octaene-1,6-diamine |
| SMILES | C=c1cccccc(N)ccccc(N)cccccc1=C |
| InChI | InChI=1S/C20H22N2/c1-17-11-5-3-7-13-19(21)15-9-10-16-20(22)14-8-4-6-12-18(17)2/h3-16H,1-2,21-22H2/b7-3-,8-4+,11-5+,12-6+,15-9+,16-10+,19-13-,20-14+ |
| InChIKey | DRBYWOWJBXYZMW-CIHXIOFTSA-N |
| XLogP | 3.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |