C24H40O5Si — CID 101213798
dimethyl (1S,6S,7S)-3-butyl-7-[tert-butyl(dimethyl)silyl]oxybicyclo[4.3.1]deca-2,4-diene-8,8-dicarboxylate (PubChem CID 101213798) has the molecular formula C24H40O5Si and a molecular weight of 436.67 g/mol. Its IUPAC name is dimethyl (1S,6S,7S)-3-butyl-7-[tert-butyl(dimethyl)silyl]oxybicyclo[4.3.1]deca-2,4-diene-8,8-dicarboxylate.
| Compound Name | dimethyl (1S,6S,7S)-3-butyl-7-[tert-butyl(dimethyl)silyl]oxybicyclo[4.3.1]deca-2,4-diene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 101213798 |
| Molecular Formula | C24H40O5Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | dimethyl (1S,6S,7S)-3-butyl-7-[tert-butyl(dimethyl)silyl]oxybicyclo[4.3.1]deca-2,4-diene-8,8-dicarboxylate |
| SMILES | CCCCC1=C[C@H]2C[C@@H](C=C1)[C@H](O[Si](C)(C)C(C)(C)C)C(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C24H40O5Si/c1-9-10-11-17-12-13-19-15-18(14-17)16-24(21(25)27-5,22(26)28-6)20(19)29-30(7,8)23(2,3)4/h12-14,18-20H,9-11,15-16H2,1-8H3/t18-,19+,20-/m0/s1 |
| InChIKey | GDPJUDYURIXEAW-ZCNNSNEGSA-N |
| XLogP | 5.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|