C20H37NO3 — CID 101213983
(E,2S,6S,8S,10S)-N-methoxy-N,2,4,6,8,10-hexamethyl-3-oxotridec-4-enamide (PubChem CID 101213983) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is (E,2S,6S,8S,10S)-N-methoxy-N,2,4,6,8,10-hexamethyl-3-oxotridec-4-enamide.
| Compound Name | (E,2S,6S,8S,10S)-N-methoxy-N,2,4,6,8,10-hexamethyl-3-oxotridec-4-enamide |
|---|---|
| PubChem CID | 101213983 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | (E,2S,6S,8S,10S)-N-methoxy-N,2,4,6,8,10-hexamethyl-3-oxotridec-4-enamide |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)/C=C(\C)C(=O)[C@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C20H37NO3/c1-9-10-14(2)11-15(3)12-16(4)13-17(5)19(22)18(6)20(23)21(7)24-8/h13-16,18H,9-12H2,1-8H3/b17-13+/t14-,15-,16-,18-/m0/s1 |
| InChIKey | CWLGHQOBPAWMME-YBZYTMMQSA-N |
| XLogP | 4.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|