About triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane
triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane (PubChem CID 101214220) has the molecular formula C18H30OSi
and a molecular weight of 290.52 g/mol. Its IUPAC name is triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane.
Molecular Properties
| Compound Name | triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane |
| PubChem CID | 101214220 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane |
| SMILES | CC[C@H](O[Si](CC)(CC)CC)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H30OSi/c1-5-18(19-20(6-2,7-3)8-4)17-14-16(17)15-12-10-9-11-13-15/h9-13,16-18H,5-8,14H2,1-4H3/t16-,17+,18-/m0/s1 |
| InChIKey | UWNWPKFFLZIWTA-KSZLIROESA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane?
The IUPAC name of triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane (CID 101214220) is triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane.
What is the SMILES notation for triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane?
The canonical SMILES for triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane is CC[C@H](O[Si](CC)(CC)CC)[C@@H]1C[C@H]1c1ccccc1.
What is the InChIKey of triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane?
The InChIKey is UWNWPKFFLZIWTA-KSZLIROESA-N. The full InChI is InChI=1S/C18H30OSi/c1-5-18(19-20(6-2,7-3)8-4)17-14-16(17)15-12-10-9-11-13-15/h9-13,16-18H,5-8,14H2,1-4H3/t16-,17+,18-/m0/s1.
What are the key properties of triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane?
triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane has a molecular weight of 290.52 g/mol, XLogP of 5.59, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1S)-1-[(1R,2R)-2-phenylcyclopropyl]propoxy]silane is sourced from PubChem (CID 101214220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).