About 5H-quinolin-1-ium-5-ide
5H-quinolin-1-ium-5-ide (PubChem CID 101214400) has the molecular formula C9H5N
and a molecular weight of 127.15 g/mol. Its IUPAC name is 5H-quinolin-1-ium-5-ide.
Molecular Properties
| Compound Name | 5H-quinolin-1-ium-5-ide |
| PubChem CID | 101214400 |
| Molecular Formula | C9H5N |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 5H-quinolin-1-ium-5-ide |
| SMILES | C1=C[C-]=C2C=CC=[N+]=C2C=1 |
| InChI | InChI=1S/C9H5N/c1-2-6-9-8(4-1)5-3-7-10-9/h1,3,5-7H |
| InChIKey | YRRKMQKMHZUQMU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5H-quinolin-1-ium-5-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-quinolin-1-ium-5-ide?
The IUPAC name of 5H-quinolin-1-ium-5-ide (CID 101214400) is 5H-quinolin-1-ium-5-ide.
What is the SMILES notation for 5H-quinolin-1-ium-5-ide?
The canonical SMILES for 5H-quinolin-1-ium-5-ide is C1=C[C-]=C2C=CC=[N+]=C2C=1.
What is the InChIKey of 5H-quinolin-1-ium-5-ide?
The InChIKey is YRRKMQKMHZUQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N/c1-2-6-9-8(4-1)5-3-7-10-9/h1,3,5-7H.
What are the key properties of 5H-quinolin-1-ium-5-ide?
5H-quinolin-1-ium-5-ide has a molecular weight of 127.15 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-quinolin-1-ium-5-ide is sourced from PubChem (CID 101214400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).