C15H26O5 — CID 101214487
(2S,3R,4R,5R)-2-(hydroxymethyl)-5-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxolane-3,4-diol (PubChem CID 101214487) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(hydroxymethyl)-5-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-(hydroxymethyl)-5-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxolane-3,4-diol |
|---|---|
| PubChem CID | 101214487 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S,3R,4R,5R)-2-(hydroxymethyl)-5-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxolane-3,4-diol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](O[C@@H]1O[C@@H](CO)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C15H26O5/c1-14(2)8-4-5-15(14,3)10(6-8)20-13-12(18)11(17)9(7-16)19-13/h8-13,16-18H,4-7H2,1-3H3/t8-,9-,10+,11-,12+,13-,15+/m0/s1 |
| InChIKey | SNSLEZBCAICYSL-SKHLOQPUSA-N |
| XLogP | 0.66 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |