C16H18 — CID 101214725
(1R,2S,4R,5S)-3,3-dimethyl-2-phenyltricyclo[3.3.0.02,4]oct-6-ene (PubChem CID 101214725) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1R,2S,4R,5S)-3,3-dimethyl-2-phenyltricyclo[3.3.0.02,4]oct-6-ene.
| Compound Name | (1R,2S,4R,5S)-3,3-dimethyl-2-phenyltricyclo[3.3.0.02,4]oct-6-ene |
|---|---|
| PubChem CID | 101214725 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (1R,2S,4R,5S)-3,3-dimethyl-2-phenyltricyclo[3.3.0.02,4]oct-6-ene |
| SMILES | CC1(C)[C@H]2[C@H]3C=CC[C@H]3[C@]21c1ccccc1 |
| InChI | InChI=1S/C16H18/c1-15(2)14-12-9-6-10-13(12)16(14,15)11-7-4-3-5-8-11/h3-9,12-14H,10H2,1-2H3/t12-,13+,14+,16+/m0/s1 |
| InChIKey | DMDPDUHRDLJFEE-DSJMHWKBSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|