C26H26P2S — CID 101214768
[(1R,2S,4R)-5,6-dimethyl-7-phenyl-7-sulfido-7-phosphoniabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane (PubChem CID 101214768) has the molecular formula C26H26P2S and a molecular weight of 432.51 g/mol. Its IUPAC name is [(1R,2S,4R)-5,6-dimethyl-7-phenyl-7-sulfido-7-phosphoniabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane.
| Compound Name | [(1R,2S,4R)-5,6-dimethyl-7-phenyl-7-sulfido-7-phosphoniabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 101214768 |
| Molecular Formula | C26H26P2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [(1R,2S,4R)-5,6-dimethyl-7-phenyl-7-sulfido-7-phosphoniabicyclo[2.2.1]hept-5-en-2-yl]-diphenylphosphane |
| SMILES | CC1=C(C)[C@@H]2[C@@H](P(c3ccccc3)c3ccccc3)C[C@H]1[P+]2([S-])c1ccccc1 |
| InChI | InChI=1S/C26H26P2S/c1-19-20(2)26-24(18-25(19)28(26,29)23-16-10-5-11-17-23)27(21-12-6-3-7-13-21)22-14-8-4-9-15-22/h3-17,24-26H,18H2,1-2H3/t24-,25+,26+,28?/m0/s1 |
| InChIKey | HSCCRAJPHOMOKY-JXLSGYPFSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|