C27H33NO3S — CID 101214911
2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-methoxy-3-pyridin-2-ylsulfanylcyclohexa-2,5-diene-1,4-dione (PubChem CID 101214911) has the molecular formula C27H33NO3S and a molecular weight of 451.63 g/mol. Its IUPAC name is 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-methoxy-3-pyridin-2-ylsulfanylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-methoxy-3-pyridin-2-ylsulfanylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101214911 |
| Molecular Formula | C27H33NO3S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-methoxy-3-pyridin-2-ylsulfanylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(C[C@]2(C)[C@@H](C)CC[C@]3(C)C(C)=CCC[C@@H]23)=C(Sc2ccccn2)C1=O |
| InChI | InChI=1S/C27H33NO3S/c1-17-9-8-10-22-26(17,3)13-12-18(2)27(22,4)16-19-20(29)15-21(31-5)24(30)25(19)32-23-11-6-7-14-28-23/h6-7,9,11,14-15,18,22H,8,10,12-13,16H2,1-5H3/t18-,22+,26+,27+/m0/s1 |
| InChIKey | BNVNRZUXONUZSA-HKRGZYMNSA-N |
| XLogP | 6.30 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|