C47H64N4O5 — CID 101214976
1,3-bis[4-[(4-decoxyphenyl)diazenyl]phenoxy]propan-2-ol (PubChem CID 101214976) has the molecular formula C47H64N4O5 and a molecular weight of 765.05 g/mol. Its IUPAC name is 1,3-bis[4-[(4-decoxyphenyl)diazenyl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[(4-decoxyphenyl)diazenyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 101214976 |
| Molecular Formula | C47H64N4O5 |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.49 |
| IUPAC Name | 1,3-bis[4-[(4-decoxyphenyl)diazenyl]phenoxy]propan-2-ol |
| SMILES | CCCCCCCCCCOc1ccc(/N=N/c2ccc(OCC(O)COc3ccc(/N=N/c4ccc(OCCCCCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H64N4O5/c1-3-5-7-9-11-13-15-17-35-53-44-27-19-39(20-28-44)48-50-41-23-31-46(32-24-41)55-37-43(52)38-56-47-33-25-42(26-34-47)51-49-40-21-29-45(30-22-40)54-36-18-16-14-12-10-8-6-4-2/h19-34,43,52H,3-18,35-38H2,1-2H3/b50-48+,51-49+ |
| InChIKey | JVMRNEUKVOVRIV-BSLTZQBWSA-N |
| XLogP | 14.38 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|