About [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate
[(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate (PubChem CID 101215110) has the molecular formula C15H17F3O6S
and a molecular weight of 382.36 g/mol. Its IUPAC name is [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate |
| PubChem CID | 101215110 |
| Molecular Formula | C15H17F3O6S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CO[C@H](C=O)C/C=C/COS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17F3O6S/c1-22-13-7-5-12(6-8-13)11-23-14(10-19)4-2-3-9-24-25(20,21)15(16,17)18/h2-3,5-8,10,14H,4,9,11H2,1H3/b3-2+/t14-/m0/s1 |
| InChIKey | WQQHFVOKFLKNMC-HSWBROFVSA-N |
| XLogP | 2.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate?
The IUPAC name of [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate (CID 101215110) is [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate.
What is the SMILES notation for [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate?
The canonical SMILES for [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate is COc1ccc(CO[C@H](C=O)C/C=C/COS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate?
The InChIKey is WQQHFVOKFLKNMC-HSWBROFVSA-N. The full InChI is InChI=1S/C15H17F3O6S/c1-22-13-7-5-12(6-8-13)11-23-14(10-19)4-2-3-9-24-25(20,21)15(16,17)18/h2-3,5-8,10,14H,4,9,11H2,1H3/b3-2+/t14-/m0/s1.
What are the key properties of [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate?
[(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate has a molecular weight of 382.36 g/mol, XLogP of 2.59, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,5S)-5-[(4-methoxyphenyl)methoxy]-6-oxohex-2-enyl] trifluoromethanesulfonate is sourced from PubChem (CID 101215110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).