C21H41NO8 — CID 101215233
N-[1-hexoxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]hexanamide (PubChem CID 101215233) has the molecular formula C21H41NO8 and a molecular weight of 435.56 g/mol. Its IUPAC name is N-[1-hexoxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]hexanamide.
| Compound Name | N-[1-hexoxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 101215233 |
| Molecular Formula | C21H41NO8 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | N-[1-hexoxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]hexanamide |
| SMILES | CCCCCCOCC(CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)NC(=O)CCCCC |
| InChI | InChI=1S/C21H41NO8/c1-3-5-7-9-11-28-13-15(22-17(24)10-8-6-4-2)14-29-21-20(27)19(26)18(25)16(12-23)30-21/h15-16,18-21,23,25-27H,3-14H2,1-2H3,(H,22,24)/t15?,16-,18+,19+,20-,21-/m1/s1 |
| InChIKey | KOWSSQYCZABYBD-WUGVNULXSA-N |
| XLogP | 0.46 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|