C14H18N2O3 — CID 101215307
(5S,6S)-4,5-dimethyl-6-phenyl-3-propanoyl-1,3,4-oxadiazinan-2-one (PubChem CID 101215307) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (5S,6S)-4,5-dimethyl-6-phenyl-3-propanoyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6S)-4,5-dimethyl-6-phenyl-3-propanoyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 101215307 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (5S,6S)-4,5-dimethyl-6-phenyl-3-propanoyl-1,3,4-oxadiazinan-2-one |
| SMILES | CCC(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C14H18N2O3/c1-4-12(17)16-14(18)19-13(10(2)15(16)3)11-8-6-5-7-9-11/h5-10,13H,4H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | TYXWFBPLRUKPNL-GXFFZTMASA-N |
| XLogP | 2.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |