C13H7Br2F5OS — CID 101216082
2,5-dibromo-3-[2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethyl]thiophene (PubChem CID 101216082) has the molecular formula C13H7Br2F5OS and a molecular weight of 466.06 g/mol. Its IUPAC name is 2,5-dibromo-3-[2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethyl]thiophene.
| Compound Name | 2,5-dibromo-3-[2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethyl]thiophene |
|---|---|
| PubChem CID | 101216082 |
| Molecular Formula | C13H7Br2F5OS |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 463.85 |
| IUPAC Name | 2,5-dibromo-3-[2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethyl]thiophene |
| SMILES | Fc1c(F)c(F)c(COCCc2cc(Br)sc2Br)c(F)c1F |
| InChI | InChI=1S/C13H7Br2F5OS/c14-7-3-5(13(15)22-7)1-2-21-4-6-8(16)10(18)12(20)11(19)9(6)17/h3H,1-2,4H2 |
| InChIKey | CWVVQWHFJWCTHL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|