C18H19NO2 — CID 101216259
(3aR,4R,6aR)-4-hydroxy-4-(quinolin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropentalen-1-one (PubChem CID 101216259) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-hydroxy-4-(quinolin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aR,4R,6aR)-4-hydroxy-4-(quinolin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 101216259 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3aR,4R,6aR)-4-hydroxy-4-(quinolin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropentalen-1-one |
| SMILES | O=C1CC[C@@H]2[C@H]1CC[C@@]2(O)Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H19NO2/c20-17-8-7-15-14(17)9-10-18(15,21)11-13-6-5-12-3-1-2-4-16(12)19-13/h1-6,14-15,21H,7-11H2/t14-,15-,18-/m1/s1 |
| InChIKey | UQBMGALJYHLROX-IIDMSEBBSA-N |
| XLogP | 2.90 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |