C61H118O14 — CID 101216333
2,3-bis[(9-hydroxy-10-methoxyoctadecanoyl)oxy]propyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate (PubChem CID 101216333) has the molecular formula C61H118O14 and a molecular weight of 1075.60 g/mol. Its IUPAC name is 2,3-bis[(9-hydroxy-10-methoxyoctadecanoyl)oxy]propyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate.
| Compound Name | 2,3-bis[(9-hydroxy-10-methoxyoctadecanoyl)oxy]propyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate |
|---|---|
| PubChem CID | 101216333 |
| Molecular Formula | C61H118O14 |
| Molecular Weight | 1075.60 g/mol |
| Exact Mass | 1074.85 |
| IUPAC Name | 2,3-bis[(9-hydroxy-10-methoxyoctadecanoyl)oxy]propyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate |
| SMILES | CCCCCCCCC(OC)C(O)CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC(O)C(CC(O)C(CCCCC)OC)OC)OC(=O)CCCCCCCC(O)C(CCCCCCCC)OC |
| InChI | InChI=1S/C61H118O14/c1-8-11-14-16-24-33-42-55(69-4)51(62)38-30-21-18-26-35-44-59(66)73-48-50(75-61(68)46-37-28-20-22-31-39-52(63)56(70-5)43-34-25-17-15-12-9-2)49-74-60(67)45-36-27-19-23-32-40-53(64)58(72-7)47-54(65)57(71-6)41-29-13-10-3/h50-58,62-65H,8-49H2,1-7H3 |
| InChIKey | IIIJFZHEPGASLO-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.60 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|