About 5-methylpyrimidine-2,4-diolate
5-methylpyrimidine-2,4-diolate (PubChem CID 101216533) has the molecular formula C5H4N2O2-2
and a molecular weight of 124.10 g/mol. Its IUPAC name is 5-methylpyrimidine-2,4-diolate.
Molecular Properties
| Compound Name | 5-methylpyrimidine-2,4-diolate |
| PubChem CID | 101216533 |
| Molecular Formula | C5H4N2O2-2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 5-methylpyrimidine-2,4-diolate |
| SMILES | Cc1cnc([O-])nc1[O-] |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9)/p-2 |
| InChIKey | RWQNBRDOKXIBIV-UHFFFAOYSA-L |
| XLogP | -1.07 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylpyrimidine-2,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrimidine-2,4-diolate?
The IUPAC name of 5-methylpyrimidine-2,4-diolate (CID 101216533) is 5-methylpyrimidine-2,4-diolate.
What is the SMILES notation for 5-methylpyrimidine-2,4-diolate?
The canonical SMILES for 5-methylpyrimidine-2,4-diolate is Cc1cnc([O-])nc1[O-].
What is the InChIKey of 5-methylpyrimidine-2,4-diolate?
The InChIKey is RWQNBRDOKXIBIV-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9)/p-2.
What are the key properties of 5-methylpyrimidine-2,4-diolate?
5-methylpyrimidine-2,4-diolate has a molecular weight of 124.10 g/mol, XLogP of -1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrimidine-2,4-diolate is sourced from PubChem (CID 101216533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).