C28H37NO4 — CID 101216584
(4S)-4-benzyl-3-[(2R)-2-(phenylmethoxymethyl)decanoyl]-1,3-oxazolidin-2-one (PubChem CID 101216584) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R)-2-(phenylmethoxymethyl)decanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R)-2-(phenylmethoxymethyl)decanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101216584 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R)-2-(phenylmethoxymethyl)decanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCC[C@H](COCc1ccccc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H37NO4/c1-2-3-4-5-6-13-18-25(21-32-20-24-16-11-8-12-17-24)27(30)29-26(22-33-28(29)31)19-23-14-9-7-10-15-23/h7-12,14-17,25-26H,2-6,13,18-22H2,1H3/t25-,26+/m1/s1 |
| InChIKey | MWIREASHAVNUAE-FTJBHMTQSA-N |
| XLogP | 6.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|